C34H41BrFNO4Si — CID 163763221
(4R)-4-[4-bromo-2-(3-methyloxiran-2-yl)oxyphenyl]-3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-3-methyl-1-phenylazetidin-2-one (PubChem CID 163763221) has the molecular formula C34H41BrFNO4Si and a molecular weight of 654.69 g/mol. Its IUPAC name is (4R)-4-[4-bromo-2-(3-methyloxiran-2-yl)oxyphenyl]-3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-3-methyl-1-phenylazetidin-2-one.
| Compound Name | (4R)-4-[4-bromo-2-(3-methyloxiran-2-yl)oxyphenyl]-3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-3-methyl-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 163763221 |
| Molecular Formula | C34H41BrFNO4Si |
| Molecular Weight | 654.69 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | (4R)-4-[4-bromo-2-(3-methyloxiran-2-yl)oxyphenyl]-3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-3-methyl-1-phenylazetidin-2-one |
| SMILES | CC1OC1Oc1cc(Br)ccc1[C@H]1N(c2ccccc2)C(=O)C1(C)CCC(O[Si](C)(C)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C34H41BrFNO4Si/c1-22-31(39-22)40-29-21-24(35)15-18-27(29)30-34(5,32(38)37(30)26-11-9-8-10-12-26)20-19-28(23-13-16-25(36)17-14-23)41-42(6,7)33(2,3)4/h8-18,21-22,28,30-31H,19-20H2,1-7H3/t22?,28?,30-,31?,34?/m1/s1 |
| InChIKey | MAAGPEHGZKDYQJ-UKFGPCBMSA-N |
| XLogP | 9.35 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.69 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|