C38H45FNO6PSi — CID 91237467
3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-[4-(3-dimethoxyphosphorylphenyl)-2-hydroxyphenyl]-1-phenylazetidin-2-one (PubChem CID 91237467) has the molecular formula C38H45FNO6PSi and a molecular weight of 689.84 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-[4-(3-dimethoxyphosphorylphenyl)-2-hydroxyphenyl]-1-phenylazetidin-2-one.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-[4-(3-dimethoxyphosphorylphenyl)-2-hydroxyphenyl]-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 91237467 |
| Molecular Formula | C38H45FNO6PSi |
| Molecular Weight | 689.84 g/mol |
| Exact Mass | 689.27 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-[4-(3-dimethoxyphosphorylphenyl)-2-hydroxyphenyl]-1-phenylazetidin-2-one |
| SMILES | COP(=O)(OC)c1cccc(-c2ccc(C3C(CCC(O[Si](C)(C)C(C)(C)C)c4ccc(F)cc4)C(=O)N3c3ccccc3)c(O)c2)c1 |
| InChI | InChI=1S/C38H45FNO6PSi/c1-38(2,3)48(6,7)46-35(26-16-19-29(39)20-17-26)23-22-33-36(40(37(33)42)30-13-9-8-10-14-30)32-21-18-28(25-34(32)41)27-12-11-15-31(24-27)47(43,44-4)45-5/h8-21,24-25,33,35-36,41H,22-23H2,1-7H3 |
| InChIKey | UBAAWAGGRBZXSL-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.84 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|