C30H26FNO3 — CID 141160315
(3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(2-hydroxy-4-phenylphenyl)-1-phenylazetidin-2-one (PubChem CID 141160315) has the molecular formula C30H26FNO3 and a molecular weight of 467.54 g/mol. Its IUPAC name is (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(2-hydroxy-4-phenylphenyl)-1-phenylazetidin-2-one.
| Compound Name | (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(2-hydroxy-4-phenylphenyl)-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 141160315 |
| Molecular Formula | C30H26FNO3 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(2-hydroxy-4-phenylphenyl)-1-phenylazetidin-2-one |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(-c3ccccc3)cc2O)N1c1ccccc1 |
| InChI | InChI=1S/C30H26FNO3/c31-23-14-11-21(12-15-23)27(33)18-17-26-29(32(30(26)35)24-9-5-2-6-10-24)25-16-13-22(19-28(25)34)20-7-3-1-4-8-20/h1-16,19,26-27,29,33-34H,17-18H2/t26-,27+,29-/m1/s1 |
| InChIKey | IAVLWOVZVVBVRL-IUAQSZDVSA-N |
| XLogP | 6.42 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|