C30H27FNO6P — CID 69257767
[2-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid (PubChem CID 69257767) has the molecular formula C30H27FNO6P and a molecular weight of 547.52 g/mol. Its IUPAC name is [2-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid.
| Compound Name | [2-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 69257767 |
| Molecular Formula | C30H27FNO6P |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | [2-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccccc2)[C@@H](c2ccc(-c3ccccc3P(=O)(O)O)cc2O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C30H27FNO6P/c31-21-11-13-22(14-12-21)32-29(25(30(32)35)16-17-26(33)19-6-2-1-3-7-19)24-15-10-20(18-27(24)34)23-8-4-5-9-28(23)39(36,37)38/h1-15,18,25-26,29,33-34H,16-17H2,(H2,36,37,38)/t25-,26+,29-/m1/s1 |
| InChIKey | KXTDDDLZMCXPBR-UWPQIUOOSA-N |
| XLogP | 5.22 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|