C30H26ClNO4 — CID 69256417
(3R,4S)-3-[(3S)-3-(3-chlorophenyl)-3-hydroxypropyl]-4-[2-hydroxy-4-(2-hydroxyphenyl)phenyl]-1-phenylazetidin-2-one (PubChem CID 69256417) has the molecular formula C30H26ClNO4 and a molecular weight of 499.99 g/mol. Its IUPAC name is (3R,4S)-3-[(3S)-3-(3-chlorophenyl)-3-hydroxypropyl]-4-[2-hydroxy-4-(2-hydroxyphenyl)phenyl]-1-phenylazetidin-2-one.
| Compound Name | (3R,4S)-3-[(3S)-3-(3-chlorophenyl)-3-hydroxypropyl]-4-[2-hydroxy-4-(2-hydroxyphenyl)phenyl]-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 69256417 |
| Molecular Formula | C30H26ClNO4 |
| Molecular Weight | 499.99 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | (3R,4S)-3-[(3S)-3-(3-chlorophenyl)-3-hydroxypropyl]-4-[2-hydroxy-4-(2-hydroxyphenyl)phenyl]-1-phenylazetidin-2-one |
| SMILES | O=C1[C@H](CC[C@H](O)c2cccc(Cl)c2)[C@@H](c2ccc(-c3ccccc3O)cc2O)N1c1ccccc1 |
| InChI | InChI=1S/C30H26ClNO4/c31-21-8-6-7-20(17-21)26(33)16-15-25-29(32(30(25)36)22-9-2-1-3-10-22)24-14-13-19(18-28(24)35)23-11-4-5-12-27(23)34/h1-14,17-18,25-26,29,33-35H,15-16H2/t25-,26+,29-/m1/s1 |
| InChIKey | RYJDPXPDBBQYCY-UWPQIUOOSA-N |
| XLogP | 6.64 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.99 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|