C36H37NO8 — CID 69258164
(3R,4S)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-[2-hydroxy-4-[2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]phenyl]-1-phenylazetidin-2-one (PubChem CID 69258164) has the molecular formula C36H37NO8 and a molecular weight of 611.69 g/mol. Its IUPAC name is (3R,4S)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-[2-hydroxy-4-[2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]phenyl]-1-phenylazetidin-2-one.
| Compound Name | (3R,4S)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-[2-hydroxy-4-[2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]phenyl]-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 69258164 |
| Molecular Formula | C36H37NO8 |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | (3R,4S)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-[2-hydroxy-4-[2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]phenyl]-1-phenylazetidin-2-one |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccccc2)[C@@H](c2ccc(-c3ccccc3[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2O)N1c1ccccc1 |
| InChI | InChI=1S/C36H37NO8/c38-20-30-32(41)33(42)34(43)35(45-30)25-14-8-7-13-24(25)22-15-16-26(29(40)19-22)31-27(17-18-28(39)21-9-3-1-4-10-21)36(44)37(31)23-11-5-2-6-12-23/h1-16,19,27-28,30-35,38-43H,17-18,20H2/t27-,28+,30-,31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | XVPBIUYTZYSXOY-DDPNQRHQSA-N |
| XLogP | 3.79 |
| TPSA | 150.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|