C36H34FNO10 — CID 59776309
(3R,4S,6S)-6-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxo-1-phenylazetidin-2-yl]-3-hydroxyphenyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 59776309) has the molecular formula C36H34FNO10 and a molecular weight of 659.66 g/mol. Its IUPAC name is (3R,4S,6S)-6-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxo-1-phenylazetidin-2-yl]-3-hydroxyphenyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3R,4S,6S)-6-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxo-1-phenylazetidin-2-yl]-3-hydroxyphenyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 59776309 |
| Molecular Formula | C36H34FNO10 |
| Molecular Weight | 659.66 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | (3R,4S,6S)-6-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxo-1-phenylazetidin-2-yl]-3-hydroxyphenyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1O[C@@H](Oc2cccc(-c3ccc([C@@H]4[C@@H](CC[C@H](O)c5ccc(F)cc5)C(=O)N4c4ccccc4)c(O)c3)c2)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C36H34FNO10/c37-22-12-9-19(10-13-22)27(39)16-15-26-29(38(34(26)44)23-6-2-1-3-7-23)25-14-11-21(18-28(25)40)20-5-4-8-24(17-20)47-36-32(43)30(41)31(42)33(48-36)35(45)46/h1-14,17-18,26-27,29-33,36,39-43H,15-16H2,(H,45,46)/t26-,27+,29-,30+,31-,32?,33?,36-/m1/s1 |
| InChIKey | CZDPWPYSSPPVMV-JIMATZPISA-N |
| XLogP | 3.69 |
| TPSA | 177.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|