C31H31F2NO8 — CID 130290451
(3R,4S)-4-[4-[(2S,3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one (PubChem CID 130290451) has the molecular formula C31H31F2NO8 and a molecular weight of 583.58 g/mol. Its IUPAC name is (3R,4S)-4-[4-[(2S,3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one.
| Compound Name | (3R,4S)-4-[4-[(2S,3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one |
|---|---|
| PubChem CID | 130290451 |
| Molecular Formula | C31H31F2NO8 |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | (3R,4S)-4-[4-[(2S,3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one |
| SMILES | CC(=O)[C@H]1O[C@@H](Oc2ccc([C@@H]3[C@@H](CC[C@H](O)c4ccc(F)cc4)C(=O)N3c3ccc(F)cc3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H31F2NO8/c1-16(35)29-27(38)26(37)28(39)31(42-29)41-22-12-4-18(5-13-22)25-23(14-15-24(36)17-2-6-19(32)7-3-17)30(40)34(25)21-10-8-20(33)9-11-21/h2-13,23-29,31,36-39H,14-15H2,1H3/t23-,24+,25-,26+,27+,28-,29-,31-/m1/s1 |
| InChIKey | FHSHVJCKNMFIFF-YVLIGPKOSA-N |
| XLogP | 2.96 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |