C31H31F2NO8 — CID 59141820
(2S,3S,4S,5R,6S)-6-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)butyl]-4-oxoazetidin-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 59141820) has the molecular formula C31H31F2NO8 and a molecular weight of 583.58 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)butyl]-4-oxoazetidin-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)butyl]-4-oxoazetidin-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 59141820 |
| Molecular Formula | C31H31F2NO8 |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)butyl]-4-oxoazetidin-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(CC[C@H]1C(=O)N(c2ccc(F)cc2)[C@@H]1c1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H31F2NO8/c1-16(17-3-7-19(32)8-4-17)2-15-23-24(34(29(23)38)21-11-9-20(33)10-12-21)18-5-13-22(14-6-18)41-31-27(37)25(35)26(36)28(42-31)30(39)40/h3-14,16,23-28,31,35-37H,2,15H2,1H3,(H,39,40)/t16?,23-,24-,25+,26+,27-,28+,31-/m1/s1 |
| InChIKey | LKUDJEGKUWJQBD-BUTLVOILSA-N |
| XLogP | 3.52 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |