C30H31F2NO8 — CID 90664239
(3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]azetidin-2-one (PubChem CID 90664239) has the molecular formula C30H31F2NO8 and a molecular weight of 571.57 g/mol. Its IUPAC name is (3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]azetidin-2-one.
| Compound Name | (3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]azetidin-2-one |
|---|---|
| PubChem CID | 90664239 |
| Molecular Formula | C30H31F2NO8 |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | (3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]azetidin-2-one |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]3O)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C30H31F2NO8/c31-18-5-1-16(2-6-18)23(35)14-13-22-25(33(29(22)39)20-9-7-19(32)8-10-20)17-3-11-21(12-4-17)40-30-28(38)27(37)26(36)24(15-34)41-30/h1-12,22-28,30,34-38H,13-15H2/t22-,23+,24-,25-,26-,27-,28-,30-/m1/s1 |
| InChIKey | DVEBXQMHLKVMSN-DWIVBKRWSA-N |
| XLogP | 2.36 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |