C32H30FNO9 — CID 11192616
(2S,3S,4S,5R,6S)-6-[4-[(3R)-1-(4-ethynylphenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 11192616) has the molecular formula C32H30FNO9 and a molecular weight of 591.59 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[4-[(3R)-1-(4-ethynylphenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[4-[(3R)-1-(4-ethynylphenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11192616 |
| Molecular Formula | C32H30FNO9 |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-[(3R)-1-(4-ethynylphenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C#Cc1ccc(N2C(=O)[C@H](CC[C@H](O)c3ccc(F)cc3)C2c2ccc(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)cc2)cc1 |
| InChI | InChI=1S/C32H30FNO9/c1-2-17-3-11-21(12-4-17)34-25(23(30(34)39)15-16-24(35)18-5-9-20(33)10-6-18)19-7-13-22(14-8-19)42-32-28(38)26(36)27(37)29(43-32)31(40)41/h1,3-14,23-29,32,35-38H,15-16H2,(H,40,41)/t23-,24+,25?,26+,27+,28-,29+,32-/m1/s1 |
| InChIKey | JEOFJQIYXZBNRR-PUBMDJGYSA-N |
| XLogP | 2.30 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|