C30H27NO6S — CID 87862266
4-[3-hydroxy-4-[(2S,3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-oxo-1-phenylazetidin-2-yl]phenyl]benzenesulfonic acid (PubChem CID 87862266) has the molecular formula C30H27NO6S and a molecular weight of 529.61 g/mol. Its IUPAC name is 4-[3-hydroxy-4-[(2S,3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-oxo-1-phenylazetidin-2-yl]phenyl]benzenesulfonic acid.
| Compound Name | 4-[3-hydroxy-4-[(2S,3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-oxo-1-phenylazetidin-2-yl]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87862266 |
| Molecular Formula | C30H27NO6S |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 4-[3-hydroxy-4-[(2S,3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-4-oxo-1-phenylazetidin-2-yl]phenyl]benzenesulfonic acid |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccccc2)[C@@H](c2ccc(-c3ccc(S(=O)(=O)O)cc3)cc2O)N1c1ccccc1 |
| InChI | InChI=1S/C30H27NO6S/c32-27(21-7-3-1-4-8-21)18-17-26-29(31(30(26)34)23-9-5-2-6-10-23)25-16-13-22(19-28(25)33)20-11-14-24(15-12-20)38(35,36)37/h1-16,19,26-27,29,32-33H,17-18H2,(H,35,36,37)/t26-,27+,29-/m1/s1 |
| InChIKey | HXXWHENGAUSHPX-IUAQSZDVSA-N |
| XLogP | 5.52 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|