C30H35BrF2N2O3 — CID 68551312
3-[4-[1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-2-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]propyl-trimethylazanium bromide (PubChem CID 68551312) has the molecular formula C30H35BrF2N2O3 and a molecular weight of 589.52 g/mol. Its IUPAC name is 3-[4-[1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-2-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]propyl-trimethylazanium bromide.
| Compound Name | 3-[4-[1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-2-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]propyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 68551312 |
| Molecular Formula | C30H35BrF2N2O3 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 3-[4-[1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-2-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]propyl-trimethylazanium bromide |
| SMILES | C[N+](C)(C)CCCOc1ccc(C2C(CC(O)Cc3ccc(F)cc3)C(=O)N2c2ccc(F)cc2)cc1.[Br-] |
| InChI | InChI=1S/C30H35F2N2O3.BrH/c1-34(2,3)17-4-18-37-27-15-7-22(8-16-27)29-28(20-26(35)19-21-5-9-23(31)10-6-21)30(36)33(29)25-13-11-24(32)12-14-25;/h5-16,26,28-29,35H,4,17-20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GABCSQBREAGONI-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|