C22H33NO6Si — CID 25215880
methyl (3S)-5-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate (PubChem CID 25215880) has the molecular formula C22H33NO6Si and a molecular weight of 435.59 g/mol. Its IUPAC name is methyl (3S)-5-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate.
| Compound Name | methyl (3S)-5-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate |
|---|---|
| PubChem CID | 25215880 |
| Molecular Formula | C22H33NO6Si |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | methyl (3S)-5-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate |
| SMILES | COC(=O)C[C@H](CC(=O)N1OC[C@H]2COc3ccccc3[C@H]21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H33NO6Si/c1-22(2,3)30(5,6)29-16(12-20(25)26-4)11-19(24)23-21-15(14-28-23)13-27-18-10-8-7-9-17(18)21/h7-10,15-16,21H,11-14H2,1-6H3/t15-,16+,21+/m1/s1 |
| InChIKey | JJHDJDZPCBGVDA-XFQAVAEZSA-N |
| XLogP | 3.85 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|