C19H20N4O5 — CID 25216129
methyl (3R)-5-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-5-oxo-3-(1,3,5-triazin-2-yl)pentanoate (PubChem CID 25216129) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is methyl (3R)-5-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-5-oxo-3-(1,3,5-triazin-2-yl)pentanoate.
| Compound Name | methyl (3R)-5-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-5-oxo-3-(1,3,5-triazin-2-yl)pentanoate |
|---|---|
| PubChem CID | 25216129 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | methyl (3R)-5-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-5-oxo-3-(1,3,5-triazin-2-yl)pentanoate |
| SMILES | COC(=O)C[C@@H](CC(=O)N1OC[C@H]2COc3ccccc3[C@H]21)c1ncncn1 |
| InChI | InChI=1S/C19H20N4O5/c1-26-17(25)7-12(19-21-10-20-11-22-19)6-16(24)23-18-13(9-28-23)8-27-15-5-3-2-4-14(15)18/h2-5,10-13,18H,6-9H2,1H3/t12-,13-,18+/m1/s1 |
| InChIKey | WNHOSEKCKRUIGZ-VFVRVIDISA-N |
| XLogP | 1.43 |
| TPSA | 103.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |