C18H19NO4S — CID 14092870
(3aR,9bS)-1-[2-(benzenesulfonyl)ethyl]-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole (PubChem CID 14092870) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is (3aR,9bS)-1-[2-(benzenesulfonyl)ethyl]-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole.
| Compound Name | (3aR,9bS)-1-[2-(benzenesulfonyl)ethyl]-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole |
|---|---|
| PubChem CID | 14092870 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (3aR,9bS)-1-[2-(benzenesulfonyl)ethyl]-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole |
| SMILES | O=S(=O)(CCN1OC[C@H]2COc3ccccc3[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C18H19NO4S/c20-24(21,15-6-2-1-3-7-15)11-10-19-18-14(13-23-19)12-22-17-9-5-4-8-16(17)18/h1-9,14,18H,10-13H2/t14-,18+/m1/s1 |
| InChIKey | DNBJYCFOKXGWHG-KDOFPFPSSA-N |
| XLogP | 2.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |