C18H21NO5 — CID 25215879
cis-methyl (1R,3S)-3-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole-1-carbonyl]cyclopentane-1-carboxylate (PubChem CID 25215879) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is cis-methyl (1R,3S)-3-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole-1-carbonyl]cyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1R,3S)-3-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole-1-carbonyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 25215879 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | cis-methyl (1R,3S)-3-[(3aR,9bS)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole-1-carbonyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](C(=O)N2OC[C@H]3COc4ccccc4[C@H]32)C1 |
| InChI | InChI=1S/C18H21NO5/c1-22-18(21)12-7-6-11(8-12)17(20)19-16-13(10-24-19)9-23-15-5-3-2-4-14(15)16/h2-5,11-13,16H,6-10H2,1H3/t11-,12+,13+,16-/m0/s1 |
| InChIKey | PDAGAXIEEOAXQF-VLXAULBPSA-N |
| XLogP | 2.10 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |