C17H25F3O3Si — CID 175036286
methyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2,4,5-trifluorophenyl)butanoate (PubChem CID 175036286) has the molecular formula C17H25F3O3Si and a molecular weight of 362.46 g/mol. Its IUPAC name is methyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2,4,5-trifluorophenyl)butanoate.
| Compound Name | methyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| PubChem CID | 175036286 |
| Molecular Formula | C17H25F3O3Si |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | methyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2,4,5-trifluorophenyl)butanoate |
| SMILES | COC(=O)C[C@H](Cc1cc(F)c(F)cc1F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H25F3O3Si/c1-17(2,3)24(5,6)23-12(9-16(21)22-4)7-11-8-14(19)15(20)10-13(11)18/h8,10,12H,7,9H2,1-6H3/t12-/m0/s1 |
| InChIKey | DVVYFUPKCFMOHP-LBPRGKRZSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|