C21H26FNO5 — CID 67931380
(3R)-7-[1-[(4-fluorophenyl)methyl]-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-3-hydroxy-5-oxohept-6-enoic acid (PubChem CID 67931380) has the molecular formula C21H26FNO5 and a molecular weight of 391.44 g/mol. Its IUPAC name is (3R)-7-[1-[(4-fluorophenyl)methyl]-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-3-hydroxy-5-oxohept-6-enoic acid.
| Compound Name | (3R)-7-[1-[(4-fluorophenyl)methyl]-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-3-hydroxy-5-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 67931380 |
| Molecular Formula | C21H26FNO5 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (3R)-7-[1-[(4-fluorophenyl)methyl]-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-3-hydroxy-5-oxohept-6-enoic acid |
| SMILES | CC(C)C1CC(=O)N(Cc2ccc(F)cc2)C1C=CC(=O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C21H26FNO5/c1-13(2)18-11-20(26)23(12-14-3-5-15(22)6-4-14)19(18)8-7-16(24)9-17(25)10-21(27)28/h3-8,13,17-19,25H,9-12H2,1-2H3,(H,27,28)/t17-,18?,19?/m1/s1 |
| InChIKey | LPFXVFZQNSDSKO-LMDPOFIKSA-N |
| XLogP | 2.55 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|