C28H41NO6Si — CID 67856608
(E)-7-[(1R,2R,4S)-2-[benzyl(methyl)carbamoyl]-5-oxo-7-oxabicyclo[2.2.1]heptan-1-yl]-3-[tert-butyl(dimethyl)silyl]oxyhept-6-enoic acid (PubChem CID 67856608) has the molecular formula C28H41NO6Si and a molecular weight of 515.72 g/mol. Its IUPAC name is (E)-7-[(1R,2R,4S)-2-[benzyl(methyl)carbamoyl]-5-oxo-7-oxabicyclo[2.2.1]heptan-1-yl]-3-[tert-butyl(dimethyl)silyl]oxyhept-6-enoic acid.
| Compound Name | (E)-7-[(1R,2R,4S)-2-[benzyl(methyl)carbamoyl]-5-oxo-7-oxabicyclo[2.2.1]heptan-1-yl]-3-[tert-butyl(dimethyl)silyl]oxyhept-6-enoic acid |
|---|---|
| PubChem CID | 67856608 |
| Molecular Formula | C28H41NO6Si |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (E)-7-[(1R,2R,4S)-2-[benzyl(methyl)carbamoyl]-5-oxo-7-oxabicyclo[2.2.1]heptan-1-yl]-3-[tert-butyl(dimethyl)silyl]oxyhept-6-enoic acid |
| SMILES | CN(Cc1ccccc1)C(=O)[C@@H]1C[C@@H]2O[C@@]1(/C=C/CCC(CC(=O)O)O[Si](C)(C)C(C)(C)C)CC2=O |
| InChI | InChI=1S/C28H41NO6Si/c1-27(2,3)36(5,6)35-21(16-25(31)32)14-10-11-15-28-18-23(30)24(34-28)17-22(28)26(33)29(4)19-20-12-8-7-9-13-20/h7-9,11-13,15,21-22,24H,10,14,16-19H2,1-6H3,(H,31,32)/b15-11+/t21?,22-,24-,28-/m0/s1 |
| InChIKey | JIQSZPVWBJULJK-NSWONSRRSA-N |
| XLogP | 4.96 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|