C22H39NO2Si — CID 44605919
N-benzyl-N-butyl-3-[tert-butyl(dimethyl)silyl]oxypentanamide (PubChem CID 44605919) has the molecular formula C22H39NO2Si and a molecular weight of 377.65 g/mol. Its IUPAC name is N-benzyl-N-butyl-3-[tert-butyl(dimethyl)silyl]oxypentanamide.
| Compound Name | N-benzyl-N-butyl-3-[tert-butyl(dimethyl)silyl]oxypentanamide |
|---|---|
| PubChem CID | 44605919 |
| Molecular Formula | C22H39NO2Si |
| Molecular Weight | 377.65 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | N-benzyl-N-butyl-3-[tert-butyl(dimethyl)silyl]oxypentanamide |
| SMILES | CCCCN(Cc1ccccc1)C(=O)CC(CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H39NO2Si/c1-8-10-16-23(18-19-14-12-11-13-15-19)21(24)17-20(9-2)25-26(6,7)22(3,4)5/h11-15,20H,8-10,16-18H2,1-7H3 |
| InChIKey | XPOXLBYRVQTJIY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|