C22H40OSi2 — CID 102184857
tert-butyl-[(E)-1-[dimethyl(2-phenylpropan-2-yl)silyl]-2-methylbut-2-enoxy]-dimethylsilane (PubChem CID 102184857) has the molecular formula C22H40OSi2 and a molecular weight of 376.73 g/mol. Its IUPAC name is tert-butyl-[(E)-1-[dimethyl(2-phenylpropan-2-yl)silyl]-2-methylbut-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-1-[dimethyl(2-phenylpropan-2-yl)silyl]-2-methylbut-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102184857 |
| Molecular Formula | C22H40OSi2 |
| Molecular Weight | 376.73 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | tert-butyl-[(E)-1-[dimethyl(2-phenylpropan-2-yl)silyl]-2-methylbut-2-enoxy]-dimethylsilane |
| SMILES | C/C=C(\C)C(O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H40OSi2/c1-12-18(2)20(23-25(10,11)21(3,4)5)24(8,9)22(6,7)19-16-14-13-15-17-19/h12-17,20H,1-11H3/b18-12+ |
| InChIKey | DLEFMWNGKBQJTD-LDADJPATSA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.73 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|