C32H44O3Si — CID 57337365
(3S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8,8,8-triphenyloctane-3,5-diol (PubChem CID 57337365) has the molecular formula C32H44O3Si and a molecular weight of 504.79 g/mol. Its IUPAC name is (3S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8,8,8-triphenyloctane-3,5-diol.
| Compound Name | (3S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8,8,8-triphenyloctane-3,5-diol |
|---|---|
| PubChem CID | 57337365 |
| Molecular Formula | C32H44O3Si |
| Molecular Weight | 504.79 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | (3S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8,8,8-triphenyloctane-3,5-diol |
| SMILES | CC[C@H](O)C[C@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H44O3Si/c1-7-28(33)23-29(34)24-30(35-36(5,6)31(2,3)4)32(25-17-11-8-12-18-25,26-19-13-9-14-20-26)27-21-15-10-16-22-27/h8-22,28-30,33-34H,7,23-24H2,1-6H3/t28-,29-,30-/m0/s1 |
| InChIKey | ZVKTTWRDYXNXCI-DTXPUJKBSA-N |
| XLogP | 7.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.79 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|