C30H35O4PSi — CID 174731090
phenyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,2-diphenyl-6-phosphanylidenehexanoate (PubChem CID 174731090) has the molecular formula C30H35O4PSi and a molecular weight of 518.67 g/mol. Its IUPAC name is phenyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,2-diphenyl-6-phosphanylidenehexanoate.
| Compound Name | phenyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,2-diphenyl-6-phosphanylidenehexanoate |
|---|---|
| PubChem CID | 174731090 |
| Molecular Formula | C30H35O4PSi |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | phenyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,2-diphenyl-6-phosphanylidenehexanoate |
| SMILES | [H]/P=C/C(=O)CC(O[Si](C)(C)C(C)(C)C)C(C(=O)Oc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H35O4PSi/c1-29(2,3)36(4,5)34-27(21-25(31)22-35)30(23-15-9-6-10-16-23,24-17-11-7-12-18-24)28(32)33-26-19-13-8-14-20-26/h6-20,22,27,35H,21H2,1-5H3 |
| InChIKey | NCCZTDGZMSDOSG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|