C23H22ClF2O2P — CID 70547127
phenyl 3,4-difluoro-2,2-diphenyl-5-phosphanylpentanoate;hydrochloride (PubChem CID 70547127) has the molecular formula C23H22ClF2O2P and a molecular weight of 434.85 g/mol. Its IUPAC name is phenyl 3,4-difluoro-2,2-diphenyl-5-phosphanylpentanoate;hydrochloride.
| Compound Name | phenyl 3,4-difluoro-2,2-diphenyl-5-phosphanylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 70547127 |
| Molecular Formula | C23H22ClF2O2P |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | phenyl 3,4-difluoro-2,2-diphenyl-5-phosphanylpentanoate;hydrochloride |
| SMILES | Cl.O=C(Oc1ccccc1)C(c1ccccc1)(c1ccccc1)C(F)C(F)CP |
| InChI | InChI=1S/C23H21F2O2P.ClH/c24-20(16-28)21(25)23(17-10-4-1-5-11-17,18-12-6-2-7-13-18)22(26)27-19-14-8-3-9-15-19;/h1-15,20-21H,16,28H2;1H |
| InChIKey | CXVKGVRDPAURLB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|