C21H15ClO4 — CID 154423526
(4-carbonochloridoylphenyl) 2-hydroxy-2,2-diphenylacetate (PubChem CID 154423526) has the molecular formula C21H15ClO4 and a molecular weight of 366.80 g/mol. Its IUPAC name is (4-carbonochloridoylphenyl) 2-hydroxy-2,2-diphenylacetate.
| Compound Name | (4-carbonochloridoylphenyl) 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 154423526 |
| Molecular Formula | C21H15ClO4 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (4-carbonochloridoylphenyl) 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(Cl)c1ccc(OC(=O)C(O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15ClO4/c22-19(23)15-11-13-18(14-12-15)26-20(24)21(25,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,25H |
| InChIKey | YTUSJNXINDNZQD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|