C36H50O5Si — CID 102018787
(E,5S)-7-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhept-6-en-3-ol (PubChem CID 102018787) has the molecular formula C36H50O5Si and a molecular weight of 590.88 g/mol. Its IUPAC name is (E,5S)-7-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhept-6-en-3-ol.
| Compound Name | (E,5S)-7-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhept-6-en-3-ol |
|---|---|
| PubChem CID | 102018787 |
| Molecular Formula | C36H50O5Si |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | (E,5S)-7-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhept-6-en-3-ol |
| SMILES | CCC(O)C(C)(C)[C@H](/C=C/OC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H50O5Si/c1-11-32(37)35(5,6)33(41-42(9,10)34(2,3)4)25-26-40-36(27-15-13-12-14-16-27,28-17-21-30(38-7)22-18-28)29-19-23-31(39-8)24-20-29/h12-26,32-33,37H,11H2,1-10H3/b26-25+/t32?,33-/m0/s1 |
| InChIKey | XYHMNBFALXWEGZ-LMIYBADNSA-N |
| XLogP | 8.71 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|