C34H43ClO4Si — CID 169074623
[(3R,4E,6E)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-7-chlorohepta-4,6-dien-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 169074623) has the molecular formula C34H43ClO4Si and a molecular weight of 579.25 g/mol. Its IUPAC name is [(3R,4E,6E)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-7-chlorohepta-4,6-dien-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,4E,6E)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-7-chlorohepta-4,6-dien-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 169074623 |
| Molecular Formula | C34H43ClO4Si |
| Molecular Weight | 579.25 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | [(3R,4E,6E)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-7-chlorohepta-4,6-dien-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc(C(OCC[C@H](/C=C/C=C/Cl)O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H43ClO4Si/c1-33(2,3)40(6,7)39-32(15-11-12-25-35)24-26-38-34(27-13-9-8-10-14-27,28-16-20-30(36-4)21-17-28)29-18-22-31(37-5)23-19-29/h8-23,25,32H,24,26H2,1-7H3/b15-11+,25-12+/t32-/m0/s1 |
| InChIKey | ZHVYVHUXJSSTGY-GQOSQZDOSA-N |
| XLogP | 9.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.25 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|