About 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium
1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium (PubChem CID 159393710) has the molecular formula C26H31O4U-
and a molecular weight of 645.56 g/mol. Its IUPAC name is 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium.
Molecular Properties
| Compound Name | 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium |
| PubChem CID | 159393710 |
| Molecular Formula | C26H31O4U- |
| Molecular Weight | 645.56 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium |
| SMILES | C.CCC(O)[CH-]OC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1.[U] |
| InChI | InChI=1S/C25H27O4.CH4.U/c1-4-22(26)18-29-25(19-8-6-5-7-9-19,20-10-14-23(27-2)15-11-20)21-12-16-24(28-3)17-13-21;;/h5-18,22,26H,4H2,1-3H3;1H4;/q-1;; |
| InChIKey | JVNSEIKUTYNZHA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 645.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium?
The IUPAC name of 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium (CID 159393710) is 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium.
What is the SMILES notation for 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium?
The canonical SMILES for 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium is C.CCC(O)[CH-]OC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1.[U].
What is the InChIKey of 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium?
The InChIKey is JVNSEIKUTYNZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27O4.CH4.U/c1-4-22(26)18-29-25(19-8-6-5-7-9-19,20-10-14-23(27-2)15-11-20)21-12-16-24(28-3)17-13-21;;/h5-18,22,26H,4H2,1-3H3;1H4;/q-1;;.
What are the key properties of 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium?
1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium has a molecular weight of 645.56 g/mol, XLogP of 5.58, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol;methane;uranium is sourced from PubChem (CID 159393710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).