C24H42O4Si — CID 10873547
(E,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,4-dimethyloct-6-en-1-ol (PubChem CID 10873547) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is (E,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,4-dimethyloct-6-en-1-ol.
| Compound Name | (E,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,4-dimethyloct-6-en-1-ol |
|---|---|
| PubChem CID | 10873547 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (E,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,4-dimethyloct-6-en-1-ol |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](CCO)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H42O4Si/c1-10-11-22(28-29(8,9)23(2,3)4)24(5,6)21(16-17-25)27-18-19-12-14-20(26-7)15-13-19/h10-15,21-22,25H,16-18H2,1-9H3/b11-10+/t21-,22+/m0/s1 |
| InChIKey | ACSYOXBWHZNMBA-MRJFECKCSA-N |
| XLogP | 5.96 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|