C24H32O2Si — CID 102328317
(1E,3S,4S,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1,6-diphenylhexa-1,5-dien-3-ol (PubChem CID 102328317) has the molecular formula C24H32O2Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (1E,3S,4S,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1,6-diphenylhexa-1,5-dien-3-ol.
| Compound Name | (1E,3S,4S,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1,6-diphenylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 102328317 |
| Molecular Formula | C24H32O2Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (1E,3S,4S,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1,6-diphenylhexa-1,5-dien-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/c1ccccc1)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H32O2Si/c1-24(2,3)27(4,5)26-23(19-17-21-14-10-7-11-15-21)22(25)18-16-20-12-8-6-9-13-20/h6-19,22-23,25H,1-5H3/b18-16+,19-17+/t22-,23-/m0/s1 |
| InChIKey | DOSZADUWDBVMAD-CHCWKLOASA-N |
| XLogP | 6.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|