C26H44OSSi — CID 102354642
tert-butyl-[(1E,3R,4S,5Z)-5-hexylsulfanyl-4-methyl-1-phenylhepta-1,5-dien-3-yl]oxy-dimethylsilane (PubChem CID 102354642) has the molecular formula C26H44OSSi and a molecular weight of 432.79 g/mol. Its IUPAC name is tert-butyl-[(1E,3R,4S,5Z)-5-hexylsulfanyl-4-methyl-1-phenylhepta-1,5-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3R,4S,5Z)-5-hexylsulfanyl-4-methyl-1-phenylhepta-1,5-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102354642 |
| Molecular Formula | C26H44OSSi |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | tert-butyl-[(1E,3R,4S,5Z)-5-hexylsulfanyl-4-methyl-1-phenylhepta-1,5-dien-3-yl]oxy-dimethylsilane |
| SMILES | C/C=C(\SCCCCCC)[C@@H](C)[C@@H](/C=C/c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44OSSi/c1-9-11-12-16-21-28-25(10-2)22(3)24(27-29(7,8)26(4,5)6)20-19-23-17-14-13-15-18-23/h10,13-15,17-20,22,24H,9,11-12,16,21H2,1-8H3/b20-19+,25-10-/t22-,24+/m0/s1 |
| InChIKey | GUIQXFXYMWDKLL-GLLHFNLSSA-N |
| XLogP | 8.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|