C15H31NO2Si — CID 73178317
N-butyl-2-[tert-butyl(dimethyl)silyl]oxypent-3-enamide (PubChem CID 73178317) has the molecular formula C15H31NO2Si and a molecular weight of 285.50 g/mol. Its IUPAC name is N-butyl-2-[tert-butyl(dimethyl)silyl]oxypent-3-enamide.
| Compound Name | N-butyl-2-[tert-butyl(dimethyl)silyl]oxypent-3-enamide |
|---|---|
| PubChem CID | 73178317 |
| Molecular Formula | C15H31NO2Si |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-butyl-2-[tert-butyl(dimethyl)silyl]oxypent-3-enamide |
| SMILES | CC=CC(O[Si](C)(C)C(C)(C)C)C(=O)NCCCC |
| InChI | InChI=1S/C15H31NO2Si/c1-8-10-12-16-14(17)13(11-9-2)18-19(6,7)15(3,4)5/h9,11,13H,8,10,12H2,1-7H3,(H,16,17) |
| InChIKey | ZEXCVRMBPKERLB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|