C19H30N2O2Si — CID 12968555
N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-cyanophenyl)acetamide (PubChem CID 12968555) has the molecular formula C19H30N2O2Si and a molecular weight of 346.55 g/mol. Its IUPAC name is N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-cyanophenyl)acetamide.
| Compound Name | N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 12968555 |
| Molecular Formula | C19H30N2O2Si |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-cyanophenyl)acetamide |
| SMILES | CCCCNC(=O)C(O[Si](C)(C)C(C)(C)C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H30N2O2Si/c1-7-8-13-21-18(22)17(23-24(5,6)19(2,3)4)16-11-9-15(14-20)10-12-16/h9-12,17H,7-8,13H2,1-6H3,(H,21,22) |
| InChIKey | JQDOVWHLRSKMKD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|