C16H33NO4Si2 — CID 174052416
3-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(dimethyl)silyl]oxyiminobut-3-enoic acid (PubChem CID 174052416) has the molecular formula C16H33NO4Si2 and a molecular weight of 359.62 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(dimethyl)silyl]oxyiminobut-3-enoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(dimethyl)silyl]oxyiminobut-3-enoic acid |
|---|---|
| PubChem CID | 174052416 |
| Molecular Formula | C16H33NO4Si2 |
| Molecular Weight | 359.62 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(dimethyl)silyl]oxyiminobut-3-enoic acid |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)C(=NO[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H33NO4Si2/c1-12(20-22(8,9)15(2,3)4)13(14(18)19)17-21-23(10,11)16(5,6)7/h1H2,2-11H3,(H,18,19) |
| InChIKey | AORWTANYUGFYTO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|