C19H39NO3Si2 — CID 134956025
[tert-butyl(dimethyl)silyl] (2Z)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylaminomethylidene)but-3-enoate (PubChem CID 134956025) has the molecular formula C19H39NO3Si2 and a molecular weight of 385.70 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (2Z)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylaminomethylidene)but-3-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (2Z)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylaminomethylidene)but-3-enoate |
|---|---|
| PubChem CID | 134956025 |
| Molecular Formula | C19H39NO3Si2 |
| Molecular Weight | 385.70 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (2Z)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylaminomethylidene)but-3-enoate |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)/C(=C/N(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39NO3Si2/c1-15(22-24(10,11)18(2,3)4)16(14-20(8)9)17(21)23-25(12,13)19(5,6)7/h14H,1H2,2-13H3/b16-14- |
| InChIKey | QXDHZMGOUAJKHA-PEZBUJJGSA-N |
| XLogP | 5.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|