[(E,4R)-oct-2-en-4-yl]boronic acid

C8H17BO2 — CID 140799449

IUPAC[(E,4R)-oct-2-en-4-yl]boronic acid
SMILESC/C=C/[C@@H](CCCC)B(O)O
InChIInChI=1S/C8H17BO2/c1-3-5-7-8(6-4-2)9(10)11/h4,6,8,10-11H,3,5,7H2,1-2H3/b6-4+/t8-/m0/s1
InChIKeyZYDHIABCOLZNNT-JQTRYQTASA-N
MW156.03 g/mol
LogP1.60
Rot. Bonds5

About [(E,4R)-oct-2-en-4-yl]boronic acid

[(E,4R)-oct-2-en-4-yl]boronic acid (PubChem CID 140799449) has the molecular formula C8H17BO2 and a molecular weight of 156.03 g/mol. Its IUPAC name is [(E,4R)-oct-2-en-4-yl]boronic acid.

Molecular Properties

Compound Name[(E,4R)-oct-2-en-4-yl]boronic acid
PubChem CID140799449
Molecular FormulaC8H17BO2
Molecular Weight156.03 g/mol
Exact Mass156.13
IUPAC Name[(E,4R)-oct-2-en-4-yl]boronic acid
SMILESC/C=C/[C@@H](CCCC)B(O)O
InChIInChI=1S/C8H17BO2/c1-3-5-7-8(6-4-2)9(10)11/h4,6,8,10-11H,3,5,7H2,1-2H3/b6-4+/t8-/m0/s1
InChIKeyZYDHIABCOLZNNT-JQTRYQTASA-N
XLogP1.60
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.03
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze [(E,4R)-oct-2-en-4-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(E,4R)-oct-2-en-4-yl]boronic acid?
The IUPAC name of [(E,4R)-oct-2-en-4-yl]boronic acid (CID 140799449) is [(E,4R)-oct-2-en-4-yl]boronic acid.
What is the SMILES notation for [(E,4R)-oct-2-en-4-yl]boronic acid?
The canonical SMILES for [(E,4R)-oct-2-en-4-yl]boronic acid is C/C=C/[C@@H](CCCC)B(O)O.
What is the InChIKey of [(E,4R)-oct-2-en-4-yl]boronic acid?
The InChIKey is ZYDHIABCOLZNNT-JQTRYQTASA-N. The full InChI is InChI=1S/C8H17BO2/c1-3-5-7-8(6-4-2)9(10)11/h4,6,8,10-11H,3,5,7H2,1-2H3/b6-4+/t8-/m0/s1.
What are the key properties of [(E,4R)-oct-2-en-4-yl]boronic acid?
[(E,4R)-oct-2-en-4-yl]boronic acid has a molecular weight of 156.03 g/mol, XLogP of 1.60, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,4R)-oct-2-en-4-yl]boronic acid is sourced from PubChem (CID 140799449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).