C8H17BO2 — CID 140799449
[(E,4R)-oct-2-en-4-yl]boronic acid (PubChem CID 140799449) has the molecular formula C8H17BO2 and a molecular weight of 156.03 g/mol. Its IUPAC name is [(E,4R)-oct-2-en-4-yl]boronic acid.
| Compound Name | [(E,4R)-oct-2-en-4-yl]boronic acid |
|---|---|
| PubChem CID | 140799449 |
| Molecular Formula | C8H17BO2 |
| Molecular Weight | 156.03 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | [(E,4R)-oct-2-en-4-yl]boronic acid |
| SMILES | C/C=C/[C@@H](CCCC)B(O)O |
| InChI | InChI=1S/C8H17BO2/c1-3-5-7-8(6-4-2)9(10)11/h4,6,8,10-11H,3,5,7H2,1-2H3/b6-4+/t8-/m0/s1 |
| InChIKey | ZYDHIABCOLZNNT-JQTRYQTASA-N |
| XLogP | 1.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.03 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|