C11H20 — CID 178125960
(4Z)-3-ethylnona-1,4-diene (PubChem CID 178125960) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (4Z)-3-ethylnona-1,4-diene.
| Compound Name | (4Z)-3-ethylnona-1,4-diene |
|---|---|
| PubChem CID | 178125960 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (4Z)-3-ethylnona-1,4-diene |
| SMILES | C=CC(/C=C\CCCC)CC |
| InChI | InChI=1S/C11H20/c1-4-7-8-9-10-11(5-2)6-3/h5,9-11H,2,4,6-8H2,1,3H3/b10-9- |
| InChIKey | COGPGPVLMSGLIE-KTKRTIGZSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|