C27H54O3Si — CID 101246564
tert-butyl (2S,3S)-3-hydroxy-2-[(E)-oct-1-enyl]-2-(trimethylsilylmethyl)undecanoate (PubChem CID 101246564) has the molecular formula C27H54O3Si and a molecular weight of 454.81 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-hydroxy-2-[(E)-oct-1-enyl]-2-(trimethylsilylmethyl)undecanoate.
| Compound Name | tert-butyl (2S,3S)-3-hydroxy-2-[(E)-oct-1-enyl]-2-(trimethylsilylmethyl)undecanoate |
|---|---|
| PubChem CID | 101246564 |
| Molecular Formula | C27H54O3Si |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | tert-butyl (2S,3S)-3-hydroxy-2-[(E)-oct-1-enyl]-2-(trimethylsilylmethyl)undecanoate |
| SMILES | CCCCCC/C=C/[C@@](C[Si](C)(C)C)(C(=O)OC(C)(C)C)[C@@H](O)CCCCCCCC |
| InChI | InChI=1S/C27H54O3Si/c1-9-11-13-15-17-19-21-24(28)27(23-31(6,7)8,25(29)30-26(3,4)5)22-20-18-16-14-12-10-2/h20,22,24,28H,9-19,21,23H2,1-8H3/b22-20+/t24-,27-/m0/s1 |
| InChIKey | LQCNLQJYNSTDSR-KKSLXMBPSA-N |
| XLogP | 8.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|