C19H38O — CID 176767686
(E,3R)-2,2-dimethylheptadec-7-en-3-ol (PubChem CID 176767686) has the molecular formula C19H38O and a molecular weight of 282.51 g/mol. Its IUPAC name is (E,3R)-2,2-dimethylheptadec-7-en-3-ol.
| Compound Name | (E,3R)-2,2-dimethylheptadec-7-en-3-ol |
|---|---|
| PubChem CID | 176767686 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | (E,3R)-2,2-dimethylheptadec-7-en-3-ol |
| SMILES | CCCCCCCCC/C=C/CCC[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C19H38O/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19(2,3)4/h13-14,18,20H,5-12,15-17H2,1-4H3/b14-13+/t18-/m1/s1 |
| InChIKey | CYKWZFVOXMDPNK-KAUXGEHWSA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|