C45H80O4 — CID 146620122
3-O-tert-butyl 1-O-ethyl 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]propanedioate (PubChem CID 146620122) has the molecular formula C45H80O4 and a molecular weight of 685.13 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]propanedioate |
|---|---|
| PubChem CID | 146620122 |
| Molecular Formula | C45H80O4 |
| Molecular Weight | 685.13 g/mol |
| Exact Mass | 684.61 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]propanedioate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)(C(=O)OCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C45H80O4/c1-7-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-45(42(46)48-9-3,43(47)49-44(4,5)6)41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-8-2/h16-19,22-25H,7-15,20-21,26-41H2,1-6H3/b18-16-,19-17-,24-22-,25-23- |
| InChIKey | WJAQDRNSPHDNDU-HBZIWDQGSA-N |
| XLogP | 14.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.13 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|