C27H47NO4 — CID 173420347
4-amino-4-[(2-methylpropan-2-yl)oxycarbonyl]docosa-13,16,19-trienoic acid (PubChem CID 173420347) has the molecular formula C27H47NO4 and a molecular weight of 449.68 g/mol. Its IUPAC name is 4-amino-4-[(2-methylpropan-2-yl)oxycarbonyl]docosa-13,16,19-trienoic acid.
| Compound Name | 4-amino-4-[(2-methylpropan-2-yl)oxycarbonyl]docosa-13,16,19-trienoic acid |
|---|---|
| PubChem CID | 173420347 |
| Molecular Formula | C27H47NO4 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | 4-amino-4-[(2-methylpropan-2-yl)oxycarbonyl]docosa-13,16,19-trienoic acid |
| SMILES | CCC=CCC=CCC=CCCCCCCCCC(N)(CCC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H47NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-27(28,23-21-24(29)30)25(31)32-26(2,3)4/h6-7,9-10,12-13H,5,8,11,14-23,28H2,1-4H3,(H,29,30) |
| InChIKey | DUEWFMWTBGLYDK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|