C28H46O3 — CID 91069053
tert-butyl 2-icosa-5,8,11,14,17-pentaenoxy-2-methylpropanoate (PubChem CID 91069053) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is tert-butyl 2-icosa-5,8,11,14,17-pentaenoxy-2-methylpropanoate.
| Compound Name | tert-butyl 2-icosa-5,8,11,14,17-pentaenoxy-2-methylpropanoate |
|---|---|
| PubChem CID | 91069053 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | tert-butyl 2-icosa-5,8,11,14,17-pentaenoxy-2-methylpropanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H46O3/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-30-28(5,6)26(29)31-27(2,3)4/h8-9,11-12,14-15,17-18,20-21H,7,10,13,16,19,22-25H2,1-6H3 |
| InChIKey | GCLOHEFTYUTEJM-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|