C31H51NO5 — CID 175345023
ethyl 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 175345023) has the molecular formula C31H51NO5 and a molecular weight of 517.75 g/mol. Its IUPAC name is ethyl 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | ethyl 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 175345023 |
| Molecular Formula | C31H51NO5 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.38 |
| IUPAC Name | ethyl 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C31H51NO5/c1-7-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-36-31(8-2,28(33)35-9-3)32-29(34)37-30(4,5)6/h10-11,13-14,16-17,19-20,22-23H,7-9,12,15,18,21,24-27H2,1-6H3,(H,32,34)/b11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | NLNHVWNGOVQQHC-RDOWKDNJSA-N |
| XLogP | 8.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|