C25H46N2O4 — CID 137379740
[(9Z,12Z)-heptadeca-9,12-dienyl] (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 137379740) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is [(9Z,12Z)-heptadeca-9,12-dienyl] (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [(9Z,12Z)-heptadeca-9,12-dienyl] (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 137379740 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | [(9Z,12Z)-heptadeca-9,12-dienyl] (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCOC(=O)[C@@H](N)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H46N2O4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-30-23(28)22(26)21-27-24(29)31-25(2,3)4/h8-9,11-12,22H,5-7,10,13-21,26H2,1-4H3,(H,27,29)/b9-8-,12-11-/t22-/m0/s1 |
| InChIKey | ILUJSRXVMCHLBJ-FQPCFBMWSA-N |
| XLogP | 5.80 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|