C31H51NO5 — CID 123961126
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-icosa-5,8,11,14,17-pentaenoxybutanoate (PubChem CID 123961126) has the molecular formula C31H51NO5 and a molecular weight of 517.75 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-icosa-5,8,11,14,17-pentaenoxybutanoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-icosa-5,8,11,14,17-pentaenoxybutanoate |
|---|---|
| PubChem CID | 123961126 |
| Molecular Formula | C31H51NO5 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.38 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-icosa-5,8,11,14,17-pentaenoxybutanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOC(CC)C(=O)OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H51NO5/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-35-28(7-2)29(33)36-27-25-32-30(34)37-31(3,4)5/h8-9,11-12,14-15,17-18,20-21,28H,6-7,10,13,16,19,22-27H2,1-5H3,(H,32,34) |
| InChIKey | SOAKZTQHZYFVMK-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|