C30H51NO6 — CID 91247723
3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyloxy]propyl octadeca-6,9,12-trienoate (PubChem CID 91247723) has the molecular formula C30H51NO6 and a molecular weight of 521.74 g/mol. Its IUPAC name is 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyloxy]propyl octadeca-6,9,12-trienoate.
| Compound Name | 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyloxy]propyl octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 91247723 |
| Molecular Formula | C30H51NO6 |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 521.37 |
| IUPAC Name | 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyloxy]propyl octadeca-6,9,12-trienoate |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)OCCCOC(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H51NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-27(32)35-25-21-26-36-28(33)23-20-24-31-29(34)37-30(2,3)4/h9-10,12-13,15-16H,5-8,11,14,17-26H2,1-4H3,(H,31,34) |
| InChIKey | REFLRCBGFUTORU-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|