C27H44O3 — CID 123930486
methyl 2-ethyl-2-icosa-5,8,11,14,17-pentaenoxybutanoate (PubChem CID 123930486) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is methyl 2-ethyl-2-icosa-5,8,11,14,17-pentaenoxybutanoate.
| Compound Name | methyl 2-ethyl-2-icosa-5,8,11,14,17-pentaenoxybutanoate |
|---|---|
| PubChem CID | 123930486 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | methyl 2-ethyl-2-icosa-5,8,11,14,17-pentaenoxybutanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOC(CC)(CC)C(=O)OC |
| InChI | InChI=1S/C27H44O3/c1-5-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-30-27(6-2,7-3)26(28)29-4/h8-9,11-12,14-15,17-18,20-21H,5-7,10,13,16,19,22-25H2,1-4H3 |
| InChIKey | HEHDZEIDPPNRIY-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|