C25H38O3 — CID 22152437
1-[5-[(9E,12E,15E)-octadeca-9,12,15-trienoxy]furan-2-yl]propan-1-one (PubChem CID 22152437) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 1-[5-[(9E,12E,15E)-octadeca-9,12,15-trienoxy]furan-2-yl]propan-1-one.
| Compound Name | 1-[5-[(9E,12E,15E)-octadeca-9,12,15-trienoxy]furan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 22152437 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 1-[5-[(9E,12E,15E)-octadeca-9,12,15-trienoxy]furan-2-yl]propan-1-one |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCCOc1ccc(C(=O)CC)o1 |
| InChI | InChI=1S/C25H38O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-27-25-21-20-24(28-25)23(26)4-2/h5-6,8-9,11-12,20-21H,3-4,7,10,13-19,22H2,1-2H3/b6-5+,9-8+,12-11+ |
| InChIKey | CIKKIPNGRGQABU-XSHSMGBESA-N |
| XLogP | 7.84 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|