C24H36O3 — CID 90788991
5-(octadeca-9,12,15-trienoxymethyl)furan-2-carbaldehyde (PubChem CID 90788991) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is 5-(octadeca-9,12,15-trienoxymethyl)furan-2-carbaldehyde.
| Compound Name | 5-(octadeca-9,12,15-trienoxymethyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 90788991 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 5-(octadeca-9,12,15-trienoxymethyl)furan-2-carbaldehyde |
| SMILES | CCC=CCC=CCC=CCCCCCCCCOCc1ccc(C=O)o1 |
| InChI | InChI=1S/C24H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-26-22-24-19-18-23(21-25)27-24/h3-4,6-7,9-10,18-19,21H,2,5,8,11-17,20,22H2,1H3 |
| InChIKey | GWZITYHITMOTIK-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|